Identification |
Name: | beta-D-Ribofuranose,1-acetate 2,3,5-tribenzoate |
CAS: | 6974-32-9 |
EINECS: | 230-220-4 |
Molecular Formula: | C28H24O9 |
Molecular Weight: | 504.49 |
InChI: | InChI=1/C28H24O9/c1-18(29)34-28-24(37-27(32)21-15-9-4-10-16-21)23(36-26(31)20-13-7-3-8-14-20)22(35-28)17-33-25(30)19-11-5-2-6-12-19/h2-16,22-24,28H,17H2,1H3/t22-,23-,24-,28-/m1/s1 |
Molecular Structure: |
 |
Properties |
Transport: | 20kgs |
Density: | 1.35 g/cm3 |
Refractive index: | 24 ° (C=1, Pyridine) |
Alpha: | 24.4 º (C=1, PYRIDINE) |
Solubility: | Appearance:White to Yellowish Crystal Transport Information:20kgs Hazard Symbols:UN
NO.
|
Appearance: | White to Yellowish Crystal |
Storage Temperature: | 2-8°C |
Usage: | An inhibitor of neutrophil-keyhole limpet hemocyanin adhesion |
Safety Data |
Hazard Symbols |
|
|
 |