| Identification | |
| Name: | Benzeneethanol, a-methyl- |
| CAS: | 698-87-3 |
| EINECS: | 211-821-0 |
| Molecular Formula: | C9H12 O |
| Molecular Weight: | 136.21 |
| InChI: | InChI=1/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 85 °C |
| Boiling Point: | 213 °C |
| Density: | 0.99 |
| Refractive index: | n20/D 1.522(lit.) |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 85 °C |
| Safety Data | |
 |
|
