| Identification | |
| Name: | Glutathione |
| Synonyms: | Glutathione(8CI);Glycine, N-(N-L-g-glutamyl-L-cysteinyl)-;Copren;Glutathion;Glutathione-SH;Glutide;Glutinal;Isethion;L-Glutathione;N-(N-L-g-Glutamyl-L-cysteinyl)glycine;Tathione;g-Glutamylcysteinylglycine;g-L-Glutamyl-L-cysteinylglycine;Glycine, L-g-glutamyl-L-cysteinyl-;GSH; |
| CAS: | 70-18-8 |
| EINECS: | 200-725-4 |
| Molecular Formula: | C10H17N3O6S |
| Molecular Weight: | 307.32 |
| InChI: | InChI=1/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.441 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.571 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | White Powder |
| Specification: |
? GSH (CAS NO.70-18-8), its Synonyms are Glutathione ; Glycine, N-(N-L-gamma-glutamyl-L-cysteinyl)- ; N-(N-L-gamma-Glutamyl-L-cysteinyl)glycine ; Copren ; Deltathione ; Glutide ; Glutinal ;?Glutathione ; Isethion ; L-Glutathione ; gamma-L-Glutamyl-L-cysteinylglycine ; gamma-L-Glutamylcysteinylglycine ; Glycine, L-gamma-glutamyl-L-cysteinyl- . It is white powder. |
| Report: | EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| HS Code: | 29309070 |
| Usage: | Glutathione may decrease the concentrations of inflammatory cytokines (IL-6, IL-18), neutrophils in lung tissue and increase the level of serum Ca2+ and be useful for the treatment of ANP. Glutathione production is regulated via distinct pathways in stressed and non-stressed cortical neurons |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
