| Identification | |
| Name: | 2-Pyrrolidinone,1-[4-(1-pyrrolidinyl)-2-butyn-1-yl]- |
| Synonyms: | 2-Pyrrolidinone,1-[4-(1-pyrrolidinyl)-2-butynyl]- (6CI,8CI,9CI);1-(2-Oxopyrrolidinyl)-4-pyrrolidinyl-2-butyne;1-[4-(1-Pyrrolidinyl)-2-butynyl]-2-pyrrolidinone;2'-Oxopyrrolidino-1-pyrrolidino-4-butyne; NSC 330497; Oxotremorin;Oxotremorine; Oxytremorine; Tremorine, oxo- |
| CAS: | 70-22-4 |
| EINECS: | 200-728-0 |
| Molecular Formula: | C12H18 N2 O |
| Molecular Weight: | 206.32 |
| InChI: | InChI=1/C12H18N2O/c15-12-6-5-11-14(12)10-4-3-9-13-7-1-2-8-13/h1-2,5-11H2 |
| Molecular Structure: | ![(C12H18N2O) 2-Pyrrolidinone,1-[4-(1-pyrrolidinyl)-2-butynyl]- (6CI,8CI,9CI);1-(2-Oxopyrrolidinyl)-4-pyrrolidinyl...](https://img1.guidechem.com/chem/e/dict/20/70-22-4.jpg) |
| Properties | |
| Transport: | UN 2810 6.1/PG 1 |
| Flash Point: | 169.1°C |
| Boiling Point: | 373.9°C at 760 mmHg |
| Density: | 1.109g/cm3 |
| Refractive index: | 1.544 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | I |
| Flash Point: | 169.1°C |
| Storage Temperature: | 2-8°C |
| Color: | clear, light yellow |
| Safety Data | |
 |
|
