| Identification | |
| Name: | DL-Lysine |
| Synonyms: | (+/-)-2,6-Diaminocaproic acid; |
| CAS: | 70-54-2 |
| EINECS: | 200-740-6 |
| Molecular Formula: | C6H14N2O2 |
| Molecular Weight: | 146.189 |
| InChI: | InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 142.2 oC |
| Boiling Point: | 311.5 oC at 760 mmHg |
| Density: | 1.125 g/cm3 |
| Refractive index: | 1.503 |
| Solubility: | Insoluble in ethanol, ethyl ether, acetone, benzene Insolulble in common neutral solvents Very freely soluble in water. Water solubility: >100 g/100 g H20 at 25 deg C In water, 5.84X10+5 mg/L at 27 deg C |
| Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 142.2 oC |
| Color: | Needles from water, hexagonal plates from dilute alcohol Colorless crystals |
| Safety Data | |
| Hazard Symbols |
T+:Very toxic
|
 |
|
