| Identification |
| Name: | 9H-Purin-6-amine,9-methyl- |
| Synonyms: | Adenine,9-methyl- (7CI,8CI); 6-Amino-9-methylpurine; 9-Methyl-9H-adenine;9-Methyladenine; N 838; N9-Methyladenine; NSC 7843 |
| CAS: | 700-00-5 |
| Molecular Formula: | C6H7 N5 |
| Molecular Weight: | 149.15 |
| InChI: | InChI=1/C6H7N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-3H,1H3,(H2,7,8,9) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 300-305 °C(lit.)
|
| Flash Point: | 187.2°C |
| Boiling Point: | 385.9°C at 760 mmHg |
| Density: | 1.6g/cm3 |
| Refractive index: | 1.807 |
| Appearance: | Off-white powder |
| Specification: | Off-White Powder usageEng:A receptor adenine derivative binding membrane brain animal cell line. Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 187.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | A receptor adenine derivative binding membrane brain animal cell line. |
| Safety Data |
| |
 |