| Identification |
| Name: | 9-Octadecenoic acid (Z)-, reaction products with 2-[(2-aminoethyl)amino]ethanol and methyl acrylate, saponified |
| Synonyms: | 9-Octadecenoic acid (9Z)-, reaction products with 2-((2-aminoethyl)amino)ethanol and methyl acrylate, saponified;9-Octadecenoic acid (Z)-, reaction products with 2-((2-aminoethyl)amino)ethanol and methyl acrylate, saponified;2-(2-aminoethylamino)ethanol; methyl prop-2-enoate; (Z)-octadec-9-enoic acid |
| CAS: | 70024-80-5 |
| EINECS: | 274-268-4 |
| Molecular Formula: | C26H52N2O5 |
| Molecular Weight: | 472.7015 |
| InChI: | InChI=1/C18H34O2.C4H12N2O.C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7;1-3-4(5)6-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-7H,1-5H2;3H,1H2,2H3/b10-9-;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
