| Identification |
| Name: | Cyclohexanamine,2-methyl- |
| Synonyms: | Cyclohexylamine,2-methyl- (6CI,7CI,8CI);2-Methylcyclohexanamine;2-Methylcyclohexylamine;NSC27455;o-Methylcyclohexylamine; |
| CAS: | 7003-32-9 |
| EINECS: | 230-277-5 |
| Molecular Formula: | C7H15N |
| Molecular Weight: | 113.2 |
| InChI: | InChI=1/C7H15N/c1-6-4-2-3-5-7(6)8/h6-7H,2-5,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2733 |
| Density: | 0.856 |
| Stability: | Stable under normal temperatures and pressures. Absorbs carbon dioxide from the air. |
| Refractive index: | 1.4555-1.4575 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | clear, colorless liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
| |
 |
