| Identification | |
| Name: | Benzene,1-(methylthio)-4-nitro- |
| Synonyms: | Sulfide,methyl p-nitrophenyl (6CI,7CI,8CI);1-(Methylthio)-4-nitrobenzene;1-Methylsulfanyl-4-nitrobenzene;4-(Methylthio)nitrobenzene;4-Nitrothioanisole;Methyl 4-nitrophenyl sulfide;Methyl p-nitrophenyl sulfide;NSC 525300;NSC 53158;p-(Methylthio)nitrobenzene;p-Nitrophenyl methylsulfide;p-Nitrothioanisole; |
| CAS: | 701-57-5 |
| Molecular Formula: | C7H7NO2S |
| Molecular Weight: | 169.2 |
| InChI: | InChI=1/C7H7NO2S/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 57 C |
| Density: | 1.27 g/cm3 |
| Refractive index: | 1.601 |
| Solubility: | Insoluble
Appearance:yellow to brownish solid Transport Information:HAZARD Hazard Symbols:UN NO. |
| Appearance: | Light yellow to brown solid |
| Flash Point: | 57 C |
| Sensitive: | Stench |
| Safety Data | |
 |
|
