| Identification |
| Name: | Phenoxyacetyl chloride |
| Synonyms: | LABOTEST-BB LT00643586; AKOS BBS-00003927; phenoxy-acetylchlorid; Phenyloxyacetyl chloride; Acyl chloride kind; Acetylchloride,phenoxy- |
| CAS: | 701-99-5 |
| EINECS: | 211-862-4 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Melting Point: | 28 - 30 |
| Density: | 1.235 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.534 |
| Solubility: | Insoluble |
| Appearance: | Colorless to brown liquid |
| Packinggroup: | II |
| HS Code: | 29189090 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
