| Identification | |
| Name: | 2,7-Dichlorofluorene |
| Synonyms: | Fluorene,2,7-dichloro- (6CI,7CI,8CI);2,7-Dichloro-9H-fluorene;NSC 73077; |
| CAS: | 7012-16-0 |
| Molecular Formula: | C13H8Cl2 |
| Molecular Weight: | 235.11 |
| InChI: | InChI=1/C13H8Cl2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 126-128 |
| Density: | 1.365 g/cm3 |
| Refractive index: | 1.66 |
| Appearance: | white crystal |
| Specification: |
2,7-Dichlorofluorene , its CAS NO. is 7012-16-0, the synonym is 2,7-Dichloro-9H-fluorene . |
| Storage Temperature: | Refrigerator |
| Usage: | Intermediate in the production of Lumefantrine. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
