| Identification | |
| Name: | 1H-Inden-1-amine,2,3-dihydro-, hydrochloride (1:1) |
| Synonyms: | 1-Indanamine,hydrochloride (6CI,7CI);1H-Inden-1-amine, 2,3-dihydro-, hydrochloride (9CI);1-Aminoindan hydrochloride;NSC 186227; |
| CAS: | 70146-15-5 |
| EINECS: | 252-158-7 |
| Molecular Formula: | C9H11N.HCl |
| Molecular Weight: | 169.65 |
| InChI: | InChI=1/C9H11N.ClH/c10-9-6-5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 206-210 |
| Density: | 1.056 g/cm3 |
| Specification: |
1H-Inden-1-amine,2,3-dihydro-, hydrochloride (1:1) , with CAS number of 70146-15-5, can be called Indan-1-ylamine hydrochloride ; 1-aminoindane hydrochloride ; 1-AminoindaneHCl ; 1-Aminoindane hydrochloride 98% ; 1-Aminoindan Hydrochloride (Rasagiline) ; 1-aminoindan hydrochloride ; 2,3-Dihydro-1H-inden-1-amine hydrochloride . |
| Safety Data | |
 |
|
