| Identification | |
| Name: | Benzenamine,4-[(4-methyl-1-piperazinyl)methyl]- |
| Synonyms: | 1-(4-Aminobenzyl)-4-methylpiperazine;4-[(4-Methyl-1-piperazinyl)methyl]benzenamine;4-[(4-Methyl-1-piperazinyl)methyl]benzeneamine;4-[(4-Methylpiperazin-1-yl)methyl]aniline;4-[(4-Methylpiperazin-1-yl)methyl]phenylamine;4-((4-methylpiperazin-1-yl)methyl)aniline;4-(4-Methylpiperazin-1-ylmethyl)phenylamine; |
| CAS: | 70261-82-4 |
| Molecular Formula: | C12H19N3 |
| Molecular Weight: | 205.3 |
| InChI: | InChI=1/C12H19N3/c1-14-6-8-15(9-7-14)10-11-2-4-12(13)5-3-11/h2-5H,6-10,13H2,1H3/p+2 |
| Molecular Structure: | ![(C12H19N3) 1-(4-Aminobenzyl)-4-methylpiperazine;4-[(4-Methyl-1-piperazinyl)methyl]benzenamine;4-[(4-Methyl-1-pi...](https://img.guidechem.com/casimg/70261-82-4.gif) |
| Properties | |
| Density: | 1.085 g/cm3 |
| Specification: |
The 4-[(4-Methylpiperazin-1-yl)methyl]aniline with the cas number 70261-82-4 is also called Benzenamine,4-[(4-methyl-1-piperazinyl)methyl]-. Its molecular formula is C12H19N3. This chemical is irritant. While using this chemical, you should be very cautious. The properties of the chemical are: (1)ACD/LogP: -0.36; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.81; (4)ACD/LogD (pH 7.4): -1.05; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 3.09; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 9.72 Å2; (13)Index of Refraction: 1.588; (14)Molar Refractivity: 63.69 cm3; (15)Molar Volume: 189.1 cm3; (16)Polarizability: 25.24×10-24cm3; (17)Surface Tension: 46.9 dyne/cm; (18)Enthalpy of Vaporization: 57.39 kJ/mol; (19)Vapour Pressure: 0.000158 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
