| Identification |
| Name: | Tris(dioxa-3,6-heptyl)amine |
| Synonyms: | Tris(2-(2-methoxyethoxy)ethyl)amine; Tris(3,6-dioxaheptyl)amine; TDA-1 |
| CAS: | 70384-51-9 |
| EINECS: | 274-590-5 |
| Molecular Formula: | C15H33NO6 |
| Molecular Weight: | 323.43 |
| InChI: | InChI=1/C15H33NO6/c1-17-10-13-20-7-4-16(5-8-21-14-11-18-2)6-9-22-15-12-19-3/h4-15H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Density: | 1.011 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4466-1.4486 |
| Water Solubility: | miscible |
| Solubility: | Miscible with water |
| Appearance: | Slight Yellow liquid |
| HS Code: | 29221980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive & Hygroscopic |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
