| Identification | |
| Name: | 1H-Indazole-6-carboxylicacid |
| Synonyms: | 6-Carboxyindazole;6-Indazolecarboxylic acid; |
| CAS: | 704-91-6 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.15 |
| InChI: | InChI=1/C8H6N2O2/c11-8(12)5-1-2-6-4-9-10-7(6)3-5/h1-4H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.507 g/cm3 |
| Refractive index: | 1.743 |
| Specification: |
The 1H-Indazole-6-carboxylic acid with the CAS number 704-91-6 is also called 6-Indazolecarboxylic acid. Its molecular formula is C8H6N2O2. This chemical belongs to the following product categories: (1)pharmacetical; (2)Building Blocks; (3)Indazole. It is irritant. While using this chemical, you should be very cautious. The properties of the chemical are: (1)ACD/LogP: 1.15; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): -1; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 6; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 65.98 Å2; (13)Index of Refraction: 1.743; (14)Molar Refractivity: 43.55 cm3; (15)Molar Volume: 107.625 cm3; (16)Polarizability: 17.265×10-24cm3; (17)Surface Tension: 85.206 dyne/cm; (18)Enthalpy of Vaporization: 73.926 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
