| Identification | |
| Name: | Benzoic acid,2-hydroxy-3-(1-methylethyl)- |
| Synonyms: | Salicylicacid, 3-isopropyl- (6CI,7CI,8CI); 2-Hydroxy-3-(1-methylethyl)benzoic acid;2-Hydroxy-3-isopropylbenzoic acid; 3-Isopropyl-2-hydroxybenzoic acid;3-Isopropylsalicylic acid |
| CAS: | 7053-88-5 |
| Molecular Formula: | C10H12 O3 |
| Molecular Weight: | 180.2 |
| InChI: | InChI=1/C10H12O3/c1-6(2)7-4-3-5-8(9(7)11)10(12)13/h3-6,11H,1-2H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 73-75 °C(lit.) |
| Flash Point: | 150.4°C |
| Boiling Point: | 301.6°C at 760 mmHg |
| Density: | 1.197g/cm3 |
| Refractive index: | 1.568 |
| Specification: | Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 150.4°C |
| Safety Data | |
 |
|
