Identification |
Name: | Ethanol,2-(2,4-diaminophenoxy)- |
Synonyms: | 2,4-Diamino-1-(2-hydroxyethoxy)benzene;2,4-Diaminophenoxyethanol;2,4-Diaminophenyl b-hydroxyethyl ether;2-(2,4-Diaminophenoxy)ethanol;2-(2',4'-Diaminophenoxy)ethanol;3-Amino-4-(2'-hydroxyethyloxy)aniline; |
CAS: | 70643-19-5 |
EINECS: | 266-357-1 |
Molecular Formula: | C8H12N2O2 |
Molecular Weight: | 168.19 |
InChI: | InChI=1/C8H12N2O2/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5,11H,3-4,9-10H2 |
Molecular Structure: |
|
Properties |
Density: | 1.274 g/cm3 |
Refractive index: | 1.637 |
Appearance: | Grey white powder |
Specification: |
Ethanol,2-(2,4-diaminophenoxy)- , its cas register number 70643-19-5. It also can be called 2-(2,4-Diaminophenoxy)ethanol ; 2-(2',4'-Diaminophenoxy)ethanol ; and 2,4-Diaminophenoxyethanol .
|
Safety Data |
|
|