| Identification | |
| Name: | Mecoprop |
| Synonyms: | 2-(4-Chloro-2-methylphenoxy)propanoic acid |
| CAS: | 7085-19-0 |
| EINECS: | 230-386-8 |
| Molecular Formula: | C10H11ClO3 |
| Molecular Weight: | 214.65 |
| InChI: | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 6.1/PG 3 |
| Flash Point: | 100 °C |
| Solubility: | Water: 734 mg/L @ 25 deg C In acetone, diethyl ether, ethanol > 1000; ethyl acetate 825; chloroform: 339 (all in g/kg, 20 deg C) |
| Specification: | Safety Statements:13-26-37/39-60-61-36/37 13:Keep away from food, drink and animal feeding stuffs 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 100 °C |
| Storage Temperature: | 2-8°C |
| Color: | Colorless crystals |
| Safety Data | |
| Hazard Symbols | |
 |
|
