| Identification |
| Name: | Cyanoacrylate Adhesive |
| Synonyms: | 2-cyano-2-propenoicaciethylester; 2-cyanoacrylicacidethylester; 2-cyano-acrylicaciethylester; 2-propenoic,2-cyano-,ethylester; 2-Propenoicacid,2-cyano-,ethylester; 910em; ace-e50; ace-ee- |
| CAS: | 7085-85-0 |
| EINECS: | 230-391-5 |
| Molecular Formula: | C6H7NO2 |
| Molecular Weight: | 7085-85-0 |
| InChI: | InChI=1/C6H7NO2/c1-3-9-6(8)5(2)4-7/h2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -22 C |
| Boiling Point: | 54 - 56 C at 3 mm Hg |
| Density: | 1.048g/cm3 |
| Stability: | Unstable - polymerizes rapidly, especially in the presence of moisture. Combustible. Incompatible with strong oxidizing agents, moisture. |
| Refractive index: | 1.434 |
| Solubility: | |
| Appearance: | colourless liquid with a distinctive odour |
| Storage Temperature: | 2-8°C |
| Usage: | A cosmetic composition |
| Safety Data |
| |
 |
