| Identification | |
| Name: | 167935-31-1 |
| Synonyms: | AC1L58R0;Maleic anhydride, dipropylene glycol polymer, 2-ethylhexyl ester;2,5-Furandione, polymer with oxybis(propanol), 2-ethylhexyl ester;2-ethylhexan-1-ol; furan-2,5-dione; 3-(3-hydroxypropoxy)propan-1-ol;Maleic anhydride, polymer, with 2-ethylhexanol and dipropylene glycol;167935-31-1;65556-71-0;68511-26-2;69029-34-1;70851-00-2 |
| CAS: | 70851-00-2 |
| Molecular Formula: | C18H34O7 |
| Molecular Weight: | 362.45836 |
| InChI: | InChI=1S/C8H18O.C6H14O3.C4H2O3/c1-3-5-6-8(4-2)7-9;7-3-1-5-9-6-2-4-8;5-3-1-2-4(6)7-3/h8-9H,3-7H2,1-2H3;7-8H,1-6H2;1-2H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 77.2°C |
| Boiling Point: | 184.6°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 77.2°C |
| Safety Data | |
 |
|
