| Identification |
| Name: | 1,1'-Biphenyl,4-pentyl- |
| Synonyms: | Biphenyl,4-pentyl-(7CI,8CI);p-Amylbiphenyl;1-Pentyl-4-phenylbenzene; |
| CAS: | 7116-96-3 |
| EINECS: | 230-421-7 |
| Molecular Formula: | C17H20 |
| Molecular Weight: | 224.3407 |
| InChI: | InChI=1S/C17H20/c1-2-3-5-8-15-11-13-17(14-12-15)16-9-6-4-7-10-16/h4,6-7,9-14H,2-3,5,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.943 |
| Refractive index: | 1.57 |
| Water Solubility: | Nonsoluble in water. Soluble in ethanol, acetone, toluene |
| Solubility: | Nonsoluble in water. Soluble in ethanol, acetone, toluene |
| Appearance: | Clear colorless liquid |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a cool, dry place. Store in a tightly closed container.
|
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| |
 |