| Identification | |
| Name: | 2H-Indol-2-one,7-fluoro-1,3-dihydro- |
| Synonyms: | 7-Fluoro-1,3-dihydro-2H-indol-2-one;7-Fluoro-1,3-dihydroindol-2-one;7-Fluoro-2-oxindole;7-Fluoroindolin-2-one; |
| CAS: | 71294-03-6 |
| Molecular Formula: | C8H6FNO |
| Molecular Weight: | 151.14 |
| InChI: | InChI=1/C8H5F2NO/c9-5-1-4-2-8(12)11-7(4)3-6(5)10/h1,3H,2H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.311 g/cm3 |
| Refractive index: | 1.536 |
| Specification: |
7-Fluorooxindole , its cas register number is 71294-03-6. It also can be called 7-Fluoroindolin-2-one ; and 7-Fluoro-1,3-dihydro-2H-indol-2-one . |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
