| Identification |
| Name: | Anthracene, 9-chloro- |
| Synonyms: | 10-Chloroanthracene;9-Chloroanthracene; |
| CAS: | 716-53-0 |
| EINECS: | 211-937-1 |
| Molecular Formula: | C14H9Cl |
| Molecular Weight: | 212.67 |
| InChI: | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 179.2°C |
| Boiling Point: | 370.1°Cat760mmHg |
| Density: | 1.253g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.717 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 179.2°C |
| Safety Data |
| |
 |
