| Identification | |
| Name: | Propanoic acid,3-phenoxy- |
| Synonyms: | Propionicacid, 3-phenoxy- (6CI,7CI,8CI); 3-Phenoxypropanoic acid; 3-Phenoxypropionicacid; Phenoxy-b-propionicacid |
| CAS: | 7170-38-9 |
| EINECS: | 230-518-4 |
| Molecular Formula: | C9H10 O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 84 C |
| Density: | 243 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: |
Appearance:off white crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | off white crystalline powder |
| Specification: | WHITE TO BEIGE FLUFFY POWDER Safety Statements:24/25-45-36/37/39-27-26 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 84 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols | |
 |
|
