| Identification | |
| Name: | 2-Amino-5-chlorobenzophenone |
| Synonyms: | (2-amino-5-chlorophenyl)(phenyl)methanone;Aminoketone;Benzophenone, 2-amino-5-chloro- (8CI);5-Chloro-2-aminobenzophenone;Benzophenone, 2-amino-5-chloro-;(2-amino-5-chloro-phenyl)-phenyl-methanone;(2-Amino-5-chlorophenyl)phenylmethanone;Methanone, (2-amino-5-chlorophenyl)phenyl-;2-Benzoyl-4-chloroaniline;2-Amino-5-chlorobenzylphenone; |
| CAS: | 719-59-5 |
| EINECS: | 211-949-7 |
| Molecular Formula: | C13H10ClNO |
| Molecular Weight: | 231.68 |
| InChI: | InChI=1/C13H10ClNO/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H,15H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.274 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.636 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | yellow crystalline powder |
| Specification: |
??2-Amino-5-chlorobenzophenone ,?its cas register number is 719-59-5. It also can be called?(2-Amino-5-chlorophenyl)phenylmethanone ; 2-Benzoyl-4-chloroaniline ; 3-14-00-00214 (Beilstein Handbook Reference) ; 5-Chloro-2-aminobenzophenone .?2-Amino-5-chlorobenzophenone (CAS NO.719-59-5) is a yellow powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29223900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A metabolite of Diazepam; it had a much weaker anticonvulsant effect. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
