| Identification | |
| Name: | Sodium lactate |
| Synonyms: | Propanoic acid, 2-hydroxy-, monosodium salt (9CI);Sodium (dl)-lactate;(+/-)-2-Hydroxypropionic acid sodium salt;2-Hydroxypropanoic acid, monosodium salt;Lactic acid, monosodium salt;Lactic acid, sodium salt (VAN);DL-Lactic acid sodium salt;Mediject L;Propanoic acid, 2-hydroxy-, monosodium salt;Monosodium lactate;Monosodium 2-hydroxypropanoate;Sodium alpha-hydroxypropionate;Lactic acid sodium salt;Lactic acid, sodium salt; |
| CAS: | 72-17-3 |
| EINECS: | 200-772-0 |
| Molecular Formula: | C3H5NaO3 |
| Molecular Weight: | 112.07 |
| InChI: | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33g/cm3 |
| Stability: | Stable. |
| Refractive index: | 1.422-1.425 |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible |
| Appearance: | colourless liquid |
| Specification: |
? Sodium Lactate , with CAS number of 72-17-3, can be called Lactic acid sodium salt ; Lactic acid, monosodium salt ; Monosodium 2-hydroxypropanoate ; Monosodium lactate ; Propanoic acid, 2-hydroxy-, monosodium salt ; Sodium alpha-hydroxypropionate ; Sodium lactate 1/6 molar in plastic container ; Sodium lactate in plastic container . Sodium Lactate (CAS NO.72-17-3) is used for food preservation, moisture, aroma, and used as a pharmaceutical raw material. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
