Identification |
Name: | Benzenamine,4,4'-dithiobis- |
Synonyms: | Aniline,4,4'-dithiodi- (6CI,7CI,8CI);Aniline, p,p'-dithiobis- (3CI);4,4'-Diaminodiphenyl disulfide;4,4'-Diaminophenyl disulfide;4-Aminophenyl disulfide;Bis(4-aminophenyl) disulfide;Bis(p-aniline)disulfide;Dithiobis[4-aminobenzene];NSC 62984;NSC 677451;VTI8;p,p'-Diaminodiphenyl disulfide;p,p'-Dithiobisaniline;p-Aminophenyldisulfide; |
CAS: | 722-27-0 |
EINECS: | 211-961-2 |
Molecular Formula: | C12H12N2S2 |
Molecular Weight: | 248.38 |
InChI: | InChI=1/C12H12N2S2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
Molecular Structure: |
 |
Properties |
Transport: | 61694 |
Melting Point: | 77-78 ºC |
Flash Point: | 224.2 ºC |
Boiling Point: | 447 ºC at 760 mmHg |
Density: | 1.34 g/cm3 |
Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. Sensitive to air. |
Refractive index: | 1.74 |
Appearance: | yellow powder |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 224.2 ºC |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |