| Identification | |
| Name: | Fenoxycarb (2-(4-Phenoxyphenoxy)ethyl]carbamic acid ethyl ester) |
| Synonyms: | Carbamicacid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester (9CI);ABG 6215;Eclipse;Eclipse (growth regulator);Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate;Fenoxycarb;Insegar;Logic;Logic (growth regulator);Phenoxycarb;Ro 13-5223;? Fenoxycarb; |
| CAS: | 72490-01-8 |
| EINECS: | 276-696-7 |
| Molecular Formula: | C17H19 N O4 |
| Molecular Weight: | 301.33706 |
| InChI: | InChI=1S/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19) |
| Molecular Structure: | ![(C17H19NO4) Carbamicacid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester (9CI);ABG 6215;Eclipse;Eclipse (growth regul...](https://img1.guidechem.com/structure/image/72490-01-8.jpg) |
| Properties | |
| Melting Point: | 53-54 deg C |
| Flash Point: | 224 °C |
| Density: | 1.148 g/cm3 |
| Solubility: | In ethanol 510, acetone 770, toluene 630, n-hexane 5.3, n-octanol 130 (all in g/L, 25 deg C). In water, 6.00 mg/L at 20 deg C [Shiu WY et al; Rev Environ Contam Toxicol 116: 15-187 (1990)] PubMed Abstract |
| Appearance: | white crystalline solid |
| Specification: |
It is a carbamate ester. Carbamates are chemically similar to, but more reactive than amides. Like amides they form polymers such as polyurethane resins. Carbamates are incompatible with strong acids and bases, and especially incompatible with strong reducing agents such as hydrides. Flammable gaseous hydrogen is produced by the combination of active metals or nitrides with carbamates. Strongly oxidizing acids, peroxides, and hydroperoxides are incompatible with carbamates. |
| Flash Point: | 224 °C |
| Color: | Colorless to white crystals |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
