| Identification | |
| Name: | 3-(4-Pyridyl)indole |
| Synonyms: | 3-(4-Pyridinyl)-1H-indole;3-(4-Pyridyl)indole |
| CAS: | 7272-84-6 |
| Molecular Formula: | C13H10N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H10N2/c1-2-4-13-11(3-1)12(9-15-13)10-5-7-14-8-6-10/h1-9,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.2°C |
| Boiling Point: | 406.7°C at 760 mmHg |
| Density: | 1.211g/cm3 |
| Stability: | Light Sensitive |
| Refractive index: | 1.688 |
| Specification: | Yellow Solid usageEng:A cell-permeable indolopyridine compound that acts as a selective, ATP-competitive inhibitor of Rho kinase (ROCK) activity |
| Flash Point: | 185.2°C |
| Usage: | A cell-permeable indolopyridine compound that acts as a selective, ATP-competitive inhibitor of Rho kinase (ROCK) activity |
| Safety Data | |
 |
|
