| Identification | |
| Name: | Benzenemethanamine,2-(1-piperidinyl)- |
| Synonyms: | 1-[2-(Aminomethyl)phenyl]piperidine;2-Piperidinobenzylamine; [2-(Piperidin-1-yl)benzyl]amine |
| CAS: | 72752-54-6 |
| Molecular Formula: | C12H18 N2 |
| Molecular Weight: | 190.28 |
| InChI: | InChI=1/C12H18N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-10,13H2 |
| Molecular Structure: | ![(C12H18N2) 1-[2-(Aminomethyl)phenyl]piperidine;2-Piperidinobenzylamine; [2-(Piperidin-1-yl)benzyl]amine](https://img1.guidechem.com/chem/e/dict/23/72752-54-6.jpg) |
| Properties | |
| Flash Point: | 135.8°C |
| Boiling Point: | 329.5°C at 760 mmHg |
| Density: | 1.047g/cm3 |
| Refractive index: | 1.568 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 135.8°C |
| Storage Temperature: | Store under an inert atmosphere |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
