| Identification | |
| Name: | Methane-13C, tribromo-(9CI) |
| Synonyms: | Bromoform-13C(6CI);Tribromomethane-13C; |
| CAS: | 72802-81-4 |
| Molecular Formula: | CHBr3 |
| Molecular Weight: | 253.74 |
| InChI: | InChI=1/CHBr3/c2-1(3)4/h1H/i1+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2515 6.1/PG 3 |
| Melting Point: | 5-8 °C(lit.) |
| Boiling Point: | 146-150 °C(lit.) |
| Density: | 2.974g/cm3 |
| Refractive index: | n20/D 1.596(lit.) |
| Specification: | Safety Statements:28-45-61 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
