| Identification | |
| Name: | L-Isoleucine |
| Synonyms: | 2-Amino-3-methylpentanoic acid, (S-(R*,R*))-;Isoleucine (USP);(2S,3S)-2-Amino-3-methylpentanoic acid;(2S,3S)-2-amino-3-methyl-pentanoic acid;Isoleucine, L- (8CI);2-Amino-3-methylvaleric acid;Pentanoic acid, 2-amino-3-methyl-, [S-(R*, R*)]-;(2S,3S)-alpha-Amino-beta-merthyl-n-valeric acid;[S-(R*,R*)]-2-Amino-3-methylpentanoic acid;Pentanoic acid, 2-amino-3-methyl-, (2S,3S)-;2-amino-3-methyl-pentanoic acid;erythro-L-Isoleucine;L-Norvaline, 3-methyl-, erythro-;(2S,3S)-alpha-Amino-beta-methyl-n-valeric acid;Ile;L-Isoleucine (JP14);Isoleucina [Spanish];alpha-Amino-beta-methylvaleric acid;Isoleucine (VAN);Valeric acid, 2-amino-3-methyl-;Isoleucinum [Latin];7-Isopropoxy-3-Phenyl Chromone;D- Isoleucine; |
| CAS: | 73-32-5 |
| EINECS: | 200-798-2 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90.3oC |
| Boiling Point: | 225.8oCat 760 mmHg |
| Density: | 1.035 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 41 o (C=4, 6N HCL) |
| Solubility: | 41.2 g/L (50 oC) |
| Appearance: | odorless white solid |
| Specification: | White crystalline powder Safety Statements:24/25-36-22 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 22:Do not breathe dust |
| HS Code: | 29224995 |
| Flash Point: | 90.3oC |
| Storage Temperature: | Store at RT. |
| Color: | Waxy, shiny, rhombic leaflets from alcohol Crystals |
| Usage: | One of the 20 amino acids encoded by our genetic code. An essential amino acid. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
