| Identification |
| Name: | 1,3-Cyclobutanedicarboxylicacid, 1-amino-, cis- |
| Synonyms: | cis-1-Aminocyclobutane-1,3-dicarboxylicacid; cis-2,4-Methanoglutamate |
| CAS: | 73550-55-7 |
| Molecular Formula: | C6H9 N O4 |
| Molecular Weight: | 159.14 |
| InChI: | InChI=1/C6H9NO4/c7-6(5(10)11)1-3(2-6)4(8)9/h3H,1-2,7H2,(H,8,9)(H,10,11)/t3-,6+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 128°C |
| Boiling Point: | 288.1°C at 760 mmHg |
| Density: | 1.568g/cm3 |
| Refractive index: | 1.587 |
| Biological Activity: | Potent, competitive and selective inhibitor of glutamate uptake. Certain confusion exists over the naming of this compound because of apparent contradictions in the literature. This is the isomer which has the carboxylic acid and the amino groups on the same side of the cyclobutyl ring. |
| Flash Point: | 128°C |
| Storage Temperature: | Store at RT |
| Safety Data |
| |
 |
