| Identification | |
| Name: | xylazine free base |
| Synonyms: | Xylazine (free base); Xylazine base; xylazine |
| CAS: | 7361-61-7 |
| EINECS: | 230-902-1 |
| Molecular Formula: | C12H16N2S |
| Molecular Weight: | 220.33 |
| InChI: | InChI=1/C12H16N2S/c1-9-5-3-6-10(2)11(9)14-12-13-7-4-8-15-12/h3,5-6H,4,7-8H2,1-2H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 140 C |
| Flash Point: | 156 |
| Boiling Point: | 334 |
| Density: | 1.15 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | Insoluble |
| Specification: |
Xylazine (7361-61-7) also can be called Xylazine hydrochloride ; 4-(Dimethylamino)phenylazobenzene ; 4H-1,3-Thiazin-2-amine, N-(2,6-dimethylphenyl)-5,6-dihydro- ; (5,6-Dihydro-4H-[1,3]thiazin-2-yl)-(2,6-dimethyl-phenyl)-amine ; Rompun ; Xylazin and ; Xylaxine . |
| Packinggroup: | III |
| Flash Point: | 156 |
| Storage Temperature: | −20°C |
| Usage: | Sedative, muscle relaxant. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
