| Identification | |
| Name: | Stilbenamine, 4'-chloro-N,N-dimethyl- |
| Synonyms: | 4-[2-(4-Chlorophenyl)ethenyl]-N,N-dimethylaniline |
| CAS: | 7378-50-9 |
| Molecular Formula: | C16H16ClN |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H16ClN/c1-18(2)16-11-7-14(8-12-16)4-3-13-5-9-15(17)10-6-13/h3-12H,1-2H3 |
| Molecular Structure: | ![(C16H16ClN) 4-[2-(4-Chlorophenyl)ethenyl]-N,N-dimethylaniline](https://img.guidechem.com/crawlimg/7378-50-9.png) |
| Properties | |
| Flash Point: | 193°C |
| Boiling Point: | 395.5°C at 760 mmHg |
| Density: | 1.158g/cm3 |
| Refractive index: | 1.667 |
| Specification: |
Stilbenamine, 4'-chloro-N,N-dimethyl- (CAS NO.7378-50-9),it can be called 4'-Chloro-4-dimethylaminostilbene ; 4'-Chloro-4-stilbenyl-N,N-dimethylamine ; 4-[2-(4-chlorophenyl)ethenyl]-N,N-dimethylaniline ; 4'-Chloro-N,N-dimethyl-4-stilbenamine ; 4'-Chloro-N,N-dimethylaminostiben and so on. |
| Flash Point: | 193°C |
| Safety Data | |
 |
|
