| Identification | |
| Name: | trimethoprim |
| Synonyms: | trimethoprim crystalline; 5-(3,4,5-trimethoxybenzyl)pyrimidine-2,4-diyldiamine; TMP; Antibiotic synergist |
| CAS: | 738-70-5 |
| EINECS: | 212-006-2 |
| Molecular Formula: | C14H18N4O3 |
| Molecular Weight: | 290.32 |
| InChI: | InChI=1/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | 271.9 oC |
| Boiling Point: | 526 oC at 760 mmHg |
| Density: | 1.252 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acids. |
| Water Solubility: | Soluble in DMSO |
| Solubility: | Soluble in DMSO |
| Appearance: | white to yellowish powder |
| Specification: |
Tetrahydrofolic acid is an essential precursor in the de novo synthesis of the intermediate THYMIDINE monophoshpate (dTMP), precursor of DNA metabolite THYMIDINE triphosphate.?2,4-Diamino-5-(3,4,5-trimethoxybenzyl)pyrimidine (CAS NO.738-70-5) is also called as Trimethoprim ; Bactrim ; Bactrim ; Cotrim ; SMZ/TMP ; Septra ; Sulfatrim ; 2,4-Pyrimidinediamine, 5-((3,4,5-trimethoxyphenyl)-methyl)- ;?5-((3,4,5-Trimethoxyphenyl)methyl)-2,4-pyrimidinediamine ; 5-25-13-00429 (Beilstein Handbook Reference) ; Abaprim ;?Anitrim ; BRN 0625127 ; Bacidal ; Bacticel?;?CCRIS 2410 ; Co-Trimoxizole ; Cotrimel ; EINECS 212-006-2 ; Espectrin ; Fortrim ; Kombinax ; Monoprim ; Pancidim ; Resprim Forte ;?Sinotrim ; Sulmeprim ; Trimethoprime [INN-French] ; UNII-AN164J8Y0X ; Velaten ; component of Bactrim and so on. |
| Packinggroup: | III |
| HS Code: | 29335995 |
| Flash Point: | 271.9 oC |
| Color: | White to cream, crystalline powder |
| Usage: | Antibacterial. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
