| Identification | |
| Name: | Benzeneacetic acid,triethylplumbyl ester |
| Synonyms: | Plumbane,triethyl[(phenylacetyl)oxy]- (9CI) |
| CAS: | 73928-21-9 |
| Molecular Formula: | C14H22 O2 Pb |
| Molecular Weight: | 415.52 |
| InChI: | InChI=1/C8H8O2.3C2H5.Pb/c9-8(10)6-7-4-2-1-3-5-7;3*1-2;/h1-5H,6H2,(H,9,10);3*1H2,2H3;/rC8H8O2.C6H15Pb/c9-8(10)6-7-4-2-1-3-5-7;1-4-7(5-2)6-3/h1-5H,6H2,(H,9,10);4-6H2,1-3H3 |
| Molecular Structure: | ![(C14H22O2Pb) Plumbane,triethyl[(phenylacetyl)oxy]- (9CI)](https://img1.guidechem.com/chem/e/dict/46/73928-21-9.jpg) |
| Properties | |
| Flash Point: | 156.2°C |
| Boiling Point: | 265.5°C at 760 mmHg |
| Specification: |
Triethyl lead phenyl acetate , its cas register number is 73928-21-9. It also can be called Plumbane, (phenylacetoxy)triethyl- ; and (Phenylacetoxy)triethyl plumbane . |
| Report: |
Lead and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 156.2°C |
| Safety Data | |
 |
|
