| Identification | |
| Name: | Benzoic acid, 4-iodo-,tributylstannyl ester |
| Synonyms: | Stannane,tributyl[(4-iodobenzoyl)oxy]- (9CI) |
| CAS: | 73940-88-2 |
| Molecular Formula: | C19H31 I O2 Sn |
| Molecular Weight: | 537.09 |
| InChI: | InChI=1/C7H5IO2.3C4H9.Sn/c8-6-3-1-5(2-4-6)7(9)10;3*1-3-4-2;/h1-4H,(H,9,10);3*1,3-4H2,2H3;/rC12H27Sn.C7H5IO2/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-6-3-1-5(2-4-6)7(9)10/h4-12H2,1-3H3;1-4H,(H,9,10) |
| Molecular Structure: | ![(C19H31IO2Sn) Stannane,tributyl[(4-iodobenzoyl)oxy]- (9CI)](https://img1.guidechem.com/chem/e/dict/34/73940-88-2.jpg) |
| Properties | |
| Specification: |
Tributyltin p-iodobenzoate , its cas register number is 73940-88-2. It also can be called Benzoic acid, p-iodo-, tributylstannyl ester ; p-Iodobenzoic acid tributylstannyl ester ; and Stannane, (4-iodobenzoyloxy)tributyl- . |
| Safety Data | |
| Hazard Symbols | |
 |
|
