| Identification | |
| Name: | 2-Propenoic acid,sodium salt (1:1) |
| Synonyms: | 2-Propenoicacid, sodium salt (9CI); Acrylic acid, sodium salt (6CI,7CI,8CI); Sodium2-propenoate; Sodium acrylate; Webac 240A1 |
| CAS: | 7446-81-3 |
| EINECS: | 231-209-7 |
| Molecular Formula: | C3H4 O2 . Na |
| Molecular Weight: | 94.04 |
| InChI: | InChI=1/C3H4O2.Na/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°C at 760 mmHg |
| Stability: | Stability May be unstable; may spontaneously polymerize. Incompatible with strong oxidizing agents. |
| Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
| Appearance: | solid |
| Flash Point: | 61.6°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
