| Identification |
| Name: | Methanone,(5-methoxy-1H-indol-2-yl)phenyl- |
| Synonyms: | (5-Methoxy-1H-indol-2-yl)phenylmethanone;D 64131 |
| CAS: | 74588-78-6 |
| Molecular Formula: | C16H13 N O2 |
| Molecular Weight: | 251.28 |
| InChI: | InChI=1/C16H13NO2/c1-19-13-7-8-14-12(9-13)10-15(17-14)16(18)11-5-3-2-4-6-11/h2-10,17H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 229.1°C |
| Boiling Point: | 455.2°C at 760 mmHg |
| Density: | 1.231g/cm3 |
| Refractive index: | 1.656 |
| Biological Activity: | Novel inhibitor of tubulin polymerization; cytotoxic and inhibits tumor cell proliferation in vitro (IC 50 = 74 nM). Prevents growth of tumor models in mice following oral administration in vivo . |
| Flash Point: | 229.1°C |
| Storage Temperature: | Store at RT |
| Safety Data |
| |
 |
