| Identification | |
| Name: | Benzeneacetonitrile, a-[(1,3-dioxolan-2-ylmethoxy)imino]- |
| Synonyms: | CGA92194; Concep II; Oxabetrinil |
| CAS: | 74782-23-3 |
| Molecular Formula: | C12H12 N2 O3 |
| Molecular Weight: | 232.26 |
| InChI: | InChI=1S/C12H12N2O3/c13-8-11(10-4-2-1-3-5-10)14-17-9-12-15-6-7-16-12/h1-5,12H,6-7,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 6.1/PG 2 |
| Flash Point: | 100 °C |
| Specification: | Safety Statements:24/25-45 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 100 °C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
