Identification |
Name: | 1-Heptanol,2-(phenylmethylene)-, 1-acetate |
Synonyms: | 1-Heptanol,2-(phenylmethylene)-, acetate (9CI); 1-Heptanol, 2-benzylidene-, acetate (8CI);a-Amylcinnamyl acetate |
CAS: | 7493-78-9 |
EINECS: | 231-339-4 |
Molecular Formula: | C16H22 O2 |
Molecular Weight: | 246.38 |
InChI: | InChI=1/C16H22O2/c1-3-4-6-11-16(18-14(2)17)13-12-15-9-7-5-8-10-15/h5,7-10,12-13,16H,3-4,6,11H2,1-2H3/b13-12+ |
Molecular Structure: |
 |
Properties |
Flash Point: | 128.3°C |
Boiling Point: | 353.9°C at 760 mmHg |
Density: | 0.986g/cm3 |
Refractive index: | 1.522 |
Specification: |
Amyl cinnamic acetate , its cas register number is 7493-78-9. It also can be called alpha-Amyl-beta-phenylacryl acetate ; alpha-Amylcinnamyl acetate ; and 1-Heptanol, 2-benzylidene-, acetate (8CI) .
|
Flash Point: | 128.3°C |
Safety Data |
|
 |