| Identification | |
| Name: | Bromoform |
| Synonyms: | methenyl tribromide; Methyl Tribromide; tribromomethane |
| CAS: | 75-25-2 |
| EINECS: | 200-854-6 |
| Molecular Formula: | CHBr3 |
| Molecular Weight: | 252.73 |
| InChI: | InChI=1/CHBr3/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2515 |
| Density: | 2.894 |
| Stability: | Stability May be an explosion hazard, especially when heated. Stable, but light-sensitive. Non-flammable. Incompatible with chemically active metals, strong bases. May contain ca 1% ethanol or 1-pentene (amylene) as a stabilizer. |
| Refractive index: | 1.595-1.5982 |
| Water Solubility: | slightly soluble, 0.301 g/100 mL |
| Solubility: | slightly soluble, 0.301 g/100 mL |
| Appearance: | colourless to yellow liquid |
| Specification: | colourless to yellow liquid Safety Statements:28-45-61-28A-36/37-16-7 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed |
| Packinggroup: | III |
| Sensitive: | Light Sensitive |
| Color: | Colorless heavy liquid Colorless to yellow liquid [Note: A solid below 47 degrees F]. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
