| Identification |
| Name: | 2-Iodopropane |
| Synonyms: | Isopropyl iodide; 2-Iodopropane,stab. with copper; 2-Iodopropane 98+ % |
| CAS: | 75-30-9 |
| EINECS: | 200-859-3 |
| Molecular Formula: | C3H7I |
| Molecular Weight: | 169.99 |
| InChI: | InChI=1/C3H7I/c1-3(2)4/h3H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2392 |
| Density: | 1.703 |
| Stability: | Stable, but may discolour on exposure to light. Air sensitive. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.4982 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble
|
| Appearance: | Clear
to amber liquid |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
