| Identification | |
| Name: | 2-Propanethiol |
| Synonyms: | Isopropyl mercaptan; Propanethiol; 96% |
| CAS: | 75-33-2 |
| EINECS: | 200-861-4 |
| Molecular Formula: | C3H8S |
| Molecular Weight: | 76.16 |
| InChI: | InChI=1/C3H8S/c1-3(2)4/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2402 |
| Density: | 0.82 |
| Stability: | Stable. Highly flammable - note low flashpoint. May form explosive mixtures with air. |
| Refractive index: | 1.4245-1.4265 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble in water |
| Appearance: | Clear liquid |
| Specification: | liquid with an exceedingly unpleasant smell Safety Statements:16-26-9-37/39-33 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 9:Keep container in a well-ventilated place 37/39:Wear suitable protective clothing, gloves and eye/face protection 33:Take precautionary measures against static discharges |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
