| Identification | |
| Name: | Acetyl Chloride |
| Synonyms: | Acetic acid chloride; Acetic chloride; Acetyl chloride? Ethanoyl chloride; ethanoyl chloride |
| CAS: | 75-36-5 |
| EINECS: | 200-865-6 |
| Molecular Formula: | C2H3ClO |
| Molecular Weight: | 78.5 |
| InChI: | InChI=1/C2H3ClO/c1-2(3)4/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1717 |
| Density: | 1.104 |
| Stability: | Stability Highly flammable. Reacts violently with DMSO, water, lower alcohols, and amines to generate toxic fumes. May form an explosive mixture with air. Note low flash point. Incompatible with water, alcohols, amines, strong bases, strong oxidizing agents, most common metals. |
| Refractive index: | 1.3876-1.3896 |
| Water Solubility: | Highly flammable |
| Solubility: | Highly flammable |
| Appearance: | colourless to light yellow liquid with a pungent |
| Specification: | colourless to light yellow liquid with a pungent Safety Statements:9-16-26-45-1/2 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 1/2:Keep locked up and out of the reach of children |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Store at RT |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless fuming liquid |
| Usage: | Acetylating agent, in testing for cholesterol, determination of water in organic liq. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
