| Identification | |
| Name: | Ethanol, 1-amino-(8CI,9CI) |
| Synonyms: | Acetaldehydeammonia (6CI,7CI); 1-Aminoethanol; Aldehyde ammonia; a-Aminoethyl alcohol |
| CAS: | 75-39-8 |
| EINECS: | 200-868-2 |
| Molecular Formula: | C2H7 N O |
| Molecular Weight: | 61.10 |
| InChI: | InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1841 |
| Melting Point: | 95-97°C (dec.) |
| Flash Point: | 22.7°C |
| Boiling Point: | 109-111°C |
| Density: | 0.967g/cm3 |
| Refractive index: | 1.431 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 22.7°C |
| Safety Data | |
 |
|
