| Identification | |
| Name: | chlorodifluoromethane |
| Synonyms: | - |
| CAS: | 75-45-6 |
| EINECS: | 200-871-9 |
| Molecular Formula: | CHClF2 |
| Molecular Weight: | 86.47 |
| InChI: | InChI=1/CHClF2/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1018/1973 |
| Flash Point: | -78 |
| Density: | 1.17 |
| Stability: | Stable. |
| Refractive index: | 1.264 (22 C) |
| Water Solubility: | Slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | Colourless gas |
| Specification: |
?Difluorochloromethane , its cas register number is 75-45-6. It also can be called Chlorodifluoromethane ; Fluorocarbon 22 ; Freon R-22 ; and Freon 22 . Difluorochloromethane (CAS NO.75-45-6) is shipped as a liquefied gas under its own vapor pressure, and?is noncombustible. Difluorochloromethane can asphyxiate by the displacement of air. Contact with the liquid can cause frostbite. |
| Report: |
It?is reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | O53 |
| Flash Point: | -78 |
| Storage Temperature: | Keep container tightly closed. Keep away from heat, sparks and flames. |
| Color: | Colorless gas Colorless gas ... [Note: Shipped as a liquefied compressed gas]. |
| Usage: | Propellant, fumigant, insecticide. |
| Safety Data | |
 |
|
