| Identification | |
| Name: | Methane, trifluoro- |
| Synonyms: | Arcton 1;Carbon trifluoride;Ecolo Ace 23;FC 23;FC 23 (fluorocarbon);FE 13;Fluoroform;Fluoryl;Freon 23;Fron 23;Genetron 23;HCFC 23;HFC 23;Methyltrifluoride;R 23;R 23 (halocarbon);Trifluoromethane (CHF3); |
| CAS: | 75-46-7 |
| EINECS: | 200-872-4 |
| Molecular Formula: | CHF3 |
| Molecular Weight: | 70.01 |
| InChI: | InChI=1/CHF3/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1984/2599 |
| Flash Point: | -112 |
| Density: | -84 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.00043 (25 C) |
| Water Solubility: | slightly |
| Solubility: | slightly |
| Appearance: | colourless gas |
| Specification: |
Fluoroform (75-46-7) also can be called Trifluoromethane ; Carbon trifluoride ; Freon 23 ; Halocarbon 23 ; R-23 .It is one of the " haloforms ", a class of compounds with the formula CHX3 (X = halogen).It is also generated biologically in small amounts apparently by decarboxylation of trifluoroacetic acid. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | O53 |
| Flash Point: | -112 |
| Storage Temperature: | May be stored over water. |
| Color: | COLORLESS GAS Liquefied gas |
| Usage: | Intermediate in organic synth, direct coolant for infrared detector cells, blowing agent for urethane foams. |
| Safety Data | |
 |
|
