| Identification | |
| Name: | Iodoform |
| Synonyms: | Triiodomethane |
| CAS: | 75-47-8 |
| EINECS: | 200-874-5 |
| Molecular Formula: | CHI3 |
| Molecular Weight: | 393.73 |
| InChI: | InChI=1/CHI3/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1851 |
| Flash Point: | 204 C |
| Density: | 4.008 |
| Stability: | Stable. Incompatible with strong oxidizing agents, reducing agents. May explode when heated. |
| Refractive index: | 1.85 |
| Water Solubility: | Insoluble. |
| Solubility: | Very slightly soluble (soluble in ether, ethanol and chloroform) |
| Appearance: | yellow powder or crystals |
| Specification: | yellow solid with a characteristic pungent and Safety Statements:26-36/37-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust |
| Packinggroup: | O53 |
| Flash Point: | 204 C |
| Sensitive: | Light Sensitive |
| Color: | Yellow powder or crystals YELLOW HEXAGONAL PRISMS OR NEEDLES FROM ACETONE |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
